Products 959601-14-0
CAS 959601-14-0 is the registry number for 1,4-Dimethyl-7-oxabicyclo(2.2.1)heptane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 959601-14-0) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: IFAMNOAMEJFCDB-UHFFFAOYSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | IFAMNOAMEJFCDB-UHFFFAOYSA-N |
| SMILES | CC12CCC(O1)(C(C2)C(=O)O)C |
Computed by PubChem (NCBI)