Products 959605-55-1
CAS 959605-55-1 appears in our catalog under these names: 2-Bromo-1-(p-tolyl)ethanone-d3, 2-Bromo-4’-methylacetophenone-d3. Offered by: MedChemExpress, TRC. Available pack sizes: 10 mg, 100 mg, 100mg, 10mg.
2-bromo-1-[4-(trideuteriomethyl)phenyl]ethanone (CAS 959605-55-1) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 216.09 g/mol. IUPAC name: 2-bromo-1-[4-(trideuteriomethyl)phenyl]ethanone. InChIKey: KRVGXFREOJHJAX-FIBGUPNXSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 216.09 g/mol |
| IUPAC name | 2-bromo-1-[4-(trideuteriomethyl)phenyl]ethanone |
| InChIKey | KRVGXFREOJHJAX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)