CAS 959611-30-4 appears in our catalog under these names: 3,9-Di(naphthalen-2-yl)perylene, 97%, 3,9–Di(naphthalen–2–yl)perylene, 3,9-Di(naphthalen-2-yl)perylene and 3,10-di(naphthalen-2-yl) perylene mixture, 99%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(1,4-diphenylenevinylene-2-methoxy-5-{2-ethylhexyloxy}-benzene)). Offered by: Chemat Brand, GLPBio, Lumtec. Available pack sizes: on request, 1g, 5g.
3,9-dinaphthalen-2-ylperylene (CAS 959611-30-4) is a chemical compound with the molecular formula C40H24 and a molecular weight of 504.6 g/mol. IUPAC name: 3,9-dinaphthalen-2-ylperylene. InChIKey: WVEOTOUYEMTBJP-UHFFFAOYSA-N.
| Molecular formula | C40H24 |
|---|---|
| Molecular weight | 504.6 g/mol |
| IUPAC name | 3,9-dinaphthalen-2-ylperylene |
| InChIKey | WVEOTOUYEMTBJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=C4C5=C6C(=CC=C5)C(=CC=C6C7=C4C3=CC=C7)C8=CC9=CC=CC=C9C=C8 |
Computed by PubChem (NCBI)