CAS 959699-23-1 is the registry number for PPARα agonist 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate (CAS 959699-23-1) is a chemical compound with the molecular formula C16H17O6P and a molecular weight of 336.28 g/mol. IUPAC name: [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate. InChIKey: YEYYONQIEGEOIL-ONEGZZNKSA-N.
| Molecular formula | C16H17O6P |
|---|---|
| Molecular weight | 336.28 g/mol |
| IUPAC name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| InChIKey | YEYYONQIEGEOIL-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C/C2=CC=C(C=C2)OP(=O)(O)O)OC |
Computed by PubChem (NCBI)