CAS 95998-69-9 is the registry number for 2,4-Dichloro-5-(trifluoromethyl)benzophenone. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 2000mg.
[2,4-dichloro-5-(trifluoromethyl)phenyl]-phenylmethanone (CAS 95998-69-9) is a chemical compound with the molecular formula C14H7Cl2F3O and a molecular weight of 319.1 g/mol. IUPAC name: [2,4-dichloro-5-(trifluoromethyl)phenyl]-phenylmethanone. InChIKey: XVTDRBGYNNOLDR-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2F3O |
|---|---|
| Molecular weight | 319.1 g/mol |
| IUPAC name | [2,4-dichloro-5-(trifluoromethyl)phenyl]-phenylmethanone |
| InChIKey | XVTDRBGYNNOLDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)