CAS 959997-70-7 is the registry number for 5-Chloro-1,3-thiazole-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2g, 1g.
5-chloro-1,3-thiazole-2-sulfonyl chloride (CAS 959997-70-7) is a chemical compound with the molecular formula C3HCl2NO2S2 and a molecular weight of 218.1 g/mol. IUPAC name: 5-chloro-1,3-thiazole-2-sulfonyl chloride. InChIKey: AKEZZYXNUISBJX-UHFFFAOYSA-N.
| Molecular formula | C3HCl2NO2S2 |
|---|---|
| Molecular weight | 218.1 g/mol |
| IUPAC name | 5-chloro-1,3-thiazole-2-sulfonyl chloride |
| InChIKey | AKEZZYXNUISBJX-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)