CAS 96-77-5 appears in our catalog under these names: Phenol disulfonic acid, 4-Hydroxy-1,3-benzenedisulfonic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100ml, 500g.
4-hydroxybenzene-1,3-disulfonic acid (CAS 96-77-5) is a chemical compound with the molecular formula C6H6O7S2 and a molecular weight of 254.2 g/mol. IUPAC name: 4-hydroxybenzene-1,3-disulfonic acid. InChIKey: JXBUOZMYKQDZFY-UHFFFAOYSA-N.
| Molecular formula | C6H6O7S2 |
|---|---|
| Molecular weight | 254.2 g/mol |
| IUPAC name | 4-hydroxybenzene-1,3-disulfonic acid |
| InChIKey | JXBUOZMYKQDZFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)