CAS 96-93-5 appears in our catalog under these names: 3–Amino–4–hydroxy–5–nitrobenzenesulfonic Acid, 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid, 95%, 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS 96-93-5) is a chemical compound with the molecular formula C6H6N2O6S and a molecular weight of 234.19 g/mol. IUPAC name: 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid. InChIKey: RHPXYZMDLOJTFF-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O6S |
|---|---|
| Molecular weight | 234.19 g/mol |
| IUPAC name | 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid |
| InChIKey | RHPXYZMDLOJTFF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)[N+](=O)[O-])S(=O)(=O)O |
Computed by PubChem (NCBI)