CAS 960080-91-5 is the registry number for 1,4-Bis(bromomethyl)-2,5-bis(1-methylethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,4-bis(bromomethyl)-2,5-di(propan-2-yl)benzene (CAS 960080-91-5) is a chemical compound with the molecular formula C14H20Br2 and a molecular weight of 348.12 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,5-di(propan-2-yl)benzene. InChIKey: YWLAIICHPDHUJF-UHFFFAOYSA-N.
| Molecular formula | C14H20Br2 |
|---|---|
| Molecular weight | 348.12 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,5-di(propan-2-yl)benzene |
| InChIKey | YWLAIICHPDHUJF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1CBr)C(C)C)CBr |
Computed by PubChem (NCBI)