CAS 960203-41-2 appears in our catalog under these names: (2–Bromophenyl)(2,4–dimethylphenyl)sulfane, (2-Bromophenyl)(2,4-dimethylphenyl)sulfane, 95%, (2-Bromophenyl)(2,4-dimethylphenyl)sulfane, 97%, (2-Bromophenyl)(2,4-dimethylphenyl)sulfane, >95% (HPLC), (2-Bromophenyl)(2,4-dimethylphenyl)sulfane, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, TRC, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 10mg, 50mg.
1-(2-bromophenyl)sulfanyl-2,4-dimethylbenzene (CAS 960203-41-2) is a chemical compound with the molecular formula C14H13BrS and a molecular weight of 293.22 g/mol. IUPAC name: 1-(2-bromophenyl)sulfanyl-2,4-dimethylbenzene. InChIKey: FGTISJUBEGSYIP-UHFFFAOYSA-N.
| Molecular formula | C14H13BrS |
|---|---|
| Molecular weight | 293.22 g/mol |
| IUPAC name | 1-(2-bromophenyl)sulfanyl-2,4-dimethylbenzene |
| InChIKey | FGTISJUBEGSYIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)