CAS 960246-24-6 is the registry number for (R)-Propiomazine. Offered by: TRC. Available pack sizes: 250mg.
1-[10-[(2R)-2-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one (CAS 960246-24-6) is a chemical compound with the molecular formula C20H24N2OS and a molecular weight of 340.5 g/mol. IUPAC name: 1-[10-[(2R)-2-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one. InChIKey: UVOIBTBFPOZKGP-CQSZACIVSA-N.
| Molecular formula | C20H24N2OS |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | 1-[10-[(2R)-2-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one |
| InChIKey | UVOIBTBFPOZKGP-CQSZACIVSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2C[C@@H](C)N(C)C |
Computed by PubChem (NCBI)