CAS 96027-74-6 appears in our catalog under these names: Amiodarone EP Impurity B HCl (N-Desethyl Amiodarone HCl), Amiodarone Impurity B, Desethyl Amiodarone Hydrochloride, >95% (HPLC), Desethylamiodarone Hydrochloride, Desethylamiodarone Hydrochloride 1.0 mg/ml in Methanol (as free base). Offered by: Chemat Brand, TRC, LoGiCal, Mikromol, TargetMol. Available pack sizes: on request, 100mg, 10mg, 25mg, 1ml, 50mg, 250mg, 0,005g.
(2-butyl-1-benzofuran-3-yl)-[4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl]methanone;hydrochloride (CAS 96027-74-6) is a chemical compound with the molecular formula C23H26ClI2NO3 and a molecular weight of 653.7 g/mol. IUPAC name: (2-butyl-1-benzofuran-3-yl)-[4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl]methanone;hydrochloride. InChIKey: OCQPMJVGWGJLLG-UHFFFAOYSA-N.
| Molecular formula | C23H26ClI2NO3 |
|---|---|
| Molecular weight | 653.7 g/mol |
| IUPAC name | (2-butyl-1-benzofuran-3-yl)-[4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl]methanone;hydrochloride |
| InChIKey | OCQPMJVGWGJLLG-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCNCC)I.Cl |
Computed by PubChem (NCBI)