Products 96027-84-8

CAS 96027-84-8 is the registry number for Amiodarone Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[4-(2-bromoethoxy)-3,5-diiodophenyl]-(2-butyl-1-benzofuran-3-yl)methanone (CAS 96027-84-8) is a chemical compound with the molecular formula C21H19BrI2O3 and a molecular weight of 653.1 g/mol. IUPAC name: [4-(2-bromoethoxy)-3,5-diiodophenyl]-(2-butyl-1-benzofuran-3-yl)methanone. InChIKey: BZONOCYTJWTZBO-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19BrI2O3
Molecular weight653.1 g/mol
IUPAC name[4-(2-bromoethoxy)-3,5-diiodophenyl]-(2-butyl-1-benzofuran-3-yl)methanone
InChIKeyBZONOCYTJWTZBO-UHFFFAOYSA-N
SMILESCCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCBr)I

Computed by PubChem (NCBI)