CAS 960294-16-0 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro[4.5]decane-6-carboxylate, 95%, tert-Butyl 2,6-diazaspiro(4.5)decane-6-carboxylate, 97%, 2,6-Diazaspiro(4.5)decane-6-carboxylic acid tert-butyl ester, 2,6-Diazaspiro[4.5]decane-6-carboxylic acid, 1,1-dimethylethyl ester, 97%, 97%, 6-Boc-2,6-diazaspiro[4.5]decane, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg, 1000mg, 500mg.
Tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate (CAS 960294-16-0) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate. InChIKey: HQYFHYDDVSZPPP-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate |
| InChIKey | HQYFHYDDVSZPPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCNC2 |
Computed by PubChem (NCBI)