Products 960403-11-6
CAS 960403-11-6 is the registry number for 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate. Offered by: TRC. Available pack sizes: 100mg.
2-(4-methylphenyl)sulfonyloxyethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CAS 960403-11-6) is a chemical compound with the molecular formula C21H22N2O5S and a molecular weight of 414.5 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyloxyethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate. InChIKey: KSOMVYFOMXATKR-QGZVFWFLSA-N.
| Molecular formula | C21H22N2O5S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyloxyethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| InChIKey | KSOMVYFOMXATKR-QGZVFWFLSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOC(=O)C2=CN=CN2[C@H](C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)