CAS 960608-17-7 appears in our catalog under these names: Tetrapeptide-21, Tetrapeptide–21, Tetrapeptide-21, 99.48%. Offered by: Chemat Brand, Creative Peptides, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 5 mg, 10 mg.
(4S)-4-[(2-aminoacetyl)amino]-5-[[(2S)-6-amino-1-(carboxymethylamino)-1-oxohexan-2-yl]amino]-5-oxopentanoic acid (CAS 960608-17-7) is a chemical compound with the molecular formula C15H27N5O7 and a molecular weight of 389.40 g/mol. IUPAC name: (4S)-4-[(2-aminoacetyl)amino]-5-[[(2S)-6-amino-1-(carboxymethylamino)-1-oxohexan-2-yl]amino]-5-oxopentanoic acid. InChIKey: CUVSTAMIHSSVKL-UWVGGRQHSA-N.
| Molecular formula | C15H27N5O7 |
|---|---|
| Molecular weight | 389.40 g/mol |
| IUPAC name | (4S)-4-[(2-aminoacetyl)amino]-5-[[(2S)-6-amino-1-(carboxymethylamino)-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | CUVSTAMIHSSVKL-UWVGGRQHSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)