CAS 96189-12-7 appears in our catalog under these names: Naphthol AS-MX Phosphate Disodium Salt, >95% (HPLC), Naphthol as-mx phosphate disodium salt. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 50 mg, 25 mg, 100 mg, 250 mg.
Disodium;[3-[(2,4-dimethylphenyl)carbamoyl]naphthalen-2-yl] phosphate (CAS 96189-12-7) is a chemical compound with the molecular formula C19H16NNa2O5P and a molecular weight of 415.3 g/mol. IUPAC name: disodium;[3-[(2,4-dimethylphenyl)carbamoyl]naphthalen-2-yl] phosphate. InChIKey: IHRJBGLDOBEMPR-UHFFFAOYSA-L.
| Molecular formula | C19H16NNa2O5P |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | disodium;[3-[(2,4-dimethylphenyl)carbamoyl]naphthalen-2-yl] phosphate |
| InChIKey | IHRJBGLDOBEMPR-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2OP(=O)([O-])[O-])C.[Na+].[Na+] |
Computed by PubChem (NCBI)