CAS 96192-35-7 appears in our catalog under these names: Fructosyl-lysine 2HCl, 98%, Fructosyl–lysine dihydrochloride, Fructosyl-lysine dihydrochloride, Fructosyl-lysine (dihydrochloride), 95.0%, 95.0%, Fructosyl-lysine (dihydrochloride), 95.0%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 5mg, 2mg, 25mg, 50 mg, Get quote.
(2S)-2-amino-6-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]hexanoic acid;dihydrochloride (CAS 96192-35-7) is a chemical compound with the molecular formula C12H26Cl2N2O7 and a molecular weight of 381.25 g/mol. IUPAC name: (2S)-2-amino-6-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]hexanoic acid;dihydrochloride. InChIKey: IRMWZZYDQZCJMX-YXZYLYLNSA-N.
| Molecular formula | C12H26Cl2N2O7 |
|---|---|
| Molecular weight | 381.25 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]hexanoic acid;dihydrochloride |
| InChIKey | IRMWZZYDQZCJMX-YXZYLYLNSA-N |
| SMILES | C(CCNCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O)C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)