Products 96193-69-0
CAS 96193-69-0 is the registry number for D-O-Phospho Threonine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg.
(2R,3S)-2-amino-3-phosphonooxybutanoic acid (CAS 96193-69-0) is a chemical compound with the molecular formula C4H10NO6P and a molecular weight of 199.10 g/mol. IUPAC name: (2R,3S)-2-amino-3-phosphonooxybutanoic acid. InChIKey: USRGIUJOYOXOQJ-STHAYSLISA-N.
| Molecular formula | C4H10NO6P |
|---|---|
| Molecular weight | 199.10 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-phosphonooxybutanoic acid |
| InChIKey | USRGIUJOYOXOQJ-STHAYSLISA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)N)OP(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
PHOSPHONOTHREONINE, (2R,3S)-2-Amino-3-(phosphonooxy)butanoic acid, D-O-Phospho Threonine, (2R,3S)-2-Amino-3-phosphonooxybutanoic acid, O-phosphono-D-threonine, D-O-Phosphothreonine, d-phosphothreonine, d-threonine phosphate, D-Threonine Dihydrogen Phosphate(ester), USRGIUJOYOXOQJ-STHAYSLISA-N