CAS 96201-22-8 is the registry number for 2-Biphenyl-4-yl-6-fluoro-4-carboxyquinoline, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
6-fluoro-2-(4-phenylphenyl)quinoline-4-carboxylic acid (CAS 96201-22-8) is a chemical compound with the molecular formula C22H14FNO2 and a molecular weight of 343.3 g/mol. IUPAC name: 6-fluoro-2-(4-phenylphenyl)quinoline-4-carboxylic acid. InChIKey: FUXXJJQOQDOBAU-UHFFFAOYSA-N.
| Molecular formula | C22H14FNO2 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 6-fluoro-2-(4-phenylphenyl)quinoline-4-carboxylic acid |
| InChIKey | FUXXJJQOQDOBAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=C(C=C(C=C4)F)C(=C3)C(=O)O |
Computed by PubChem (NCBI)