Products 96236-05-4
CAS 96236-05-4 appears in our catalog under these names: 5-Methoxytryptamine-a,a,b,b-d4, >95% (HPLC), 5-Methoxytryptamine-Alpha,Alpha,Beta,Beta-d4, >95% (HPLC), 5-Methoxytryptamine-alpha,alpha,beta,beta-d4, 98 atom % D, min 98% Chemical Purity, 5–methoxy Tryptamine–d4, 5-Methoxytryptamine-d4, 99.7%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10 mg, 1 mg, 5 mg.
1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethanamine (CAS 96236-05-4) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 194.27 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethanamine. InChIKey: JTEJPPKMYBDEMY-CQOLUAMGSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethanamine |
| InChIKey | JTEJPPKMYBDEMY-CQOLUAMGSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)OC)C([2H])([2H])N |
Computed by PubChem (NCBI)