Products 96250-35-0
CAS 96250-35-0 is the registry number for 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
2,2,3,3,3-pentafluoropropyl 2-fluoroprop-2-enoate (CAS 96250-35-0) is a chemical compound with the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. IUPAC name: 2,2,3,3,3-pentafluoropropyl 2-fluoroprop-2-enoate. InChIKey: KOEWOWNPLYLJOW-UHFFFAOYSA-N.
| Molecular formula | C6H4F6O2 |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoropropyl 2-fluoroprop-2-enoate |
| InChIKey | KOEWOWNPLYLJOW-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OCC(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)