CAS 96305-22-5 is the registry number for Dexpanthenol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-5-propan-2-yloxolane-2,3-dione (CAS 96305-22-5) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 4,4-dimethyl-5-propan-2-yloxolane-2,3-dione. InChIKey: HSRGUOMPBPGXNU-UHFFFAOYSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4,4-dimethyl-5-propan-2-yloxolane-2,3-dione |
| InChIKey | HSRGUOMPBPGXNU-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(C(=O)C(=O)O1)(C)C |
Computed by PubChem (NCBI)