Products 96394-42-2

CAS 96394-42-2 is the registry number for tert-Butyl N-(2-bromoacetyl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-bromoacetyl)carbamate (CAS 96394-42-2) is a chemical compound with the molecular formula C7H12BrNO3 and a molecular weight of 238.08 g/mol. IUPAC name: tert-butyl N-(2-bromoacetyl)carbamate. InChIKey: PIBOUPWSAWJWMG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12BrNO3
Molecular weight238.08 g/mol
IUPAC nametert-butyl N-(2-bromoacetyl)carbamate
InChIKeyPIBOUPWSAWJWMG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(=O)CBr

Computed by PubChem (NCBI)