Products 96436-73-6
CAS 96436-73-6 is the registry number for AHR 10718. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-propan-2-ylurea;(Z)-but-2-enedioic acid (CAS 96436-73-6) is a chemical compound with the molecular formula C22H35N3O7S and a molecular weight of 485.6 g/mol. IUPAC name: 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-propan-2-ylurea;(Z)-but-2-enedioic acid. InChIKey: CMKAKNPPMGLPRW-BTJKTKAUSA-N.
| Molecular formula | C22H35N3O7S |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-propan-2-ylurea;(Z)-but-2-enedioic acid |
| InChIKey | CMKAKNPPMGLPRW-BTJKTKAUSA-N |
| SMILES | CCN(CC)CCNC(=O)N(CCS(=O)(=O)C1=CC=CC=C1)C(C)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)