Products 96460-17-2
CAS 96460-17-2 is the registry number for 4-[(2,2-Dichloroacetyl)amino]phenyl 2-furancarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-[(2,2-dichloroacetyl)amino]phenyl] furan-2-carboxylate (CAS 96460-17-2) is a chemical compound with the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. IUPAC name: [4-[(2,2-dichloroacetyl)amino]phenyl] furan-2-carboxylate. InChIKey: SMKWFGIIDULNSB-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4 |
|---|---|
| Molecular weight | 314.12 g/mol |
| IUPAC name | [4-[(2,2-dichloroacetyl)amino]phenyl] furan-2-carboxylate |
| InChIKey | SMKWFGIIDULNSB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)OC2=CC=C(C=C2)NC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)