CAS 125138-49-0 is the registry number for 1,5-Dichloro-2-methoxy-4-(4-nitrophenoxy)benzene. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
1,5-dichloro-2-methoxy-4-(4-nitrophenoxy)benzene (CAS 125138-49-0) is a chemical compound with the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. IUPAC name: 1,5-dichloro-2-methoxy-4-(4-nitrophenoxy)benzene. InChIKey: MVFSOMFASDJKKD-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4 |
|---|---|
| Molecular weight | 314.12 g/mol |
| IUPAC name | 1,5-dichloro-2-methoxy-4-(4-nitrophenoxy)benzene |
| InChIKey | MVFSOMFASDJKKD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Cl)Cl)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)