CAS 96463-09-1 is the registry number for Bis((perchlorophenyl)thio)methane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethylsulfanyl]benzene (CAS 96463-09-1) is a chemical compound with the molecular formula C13H2Cl10S2 and a molecular weight of 576.8 g/mol. IUPAC name: 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethylsulfanyl]benzene. InChIKey: BUNBGJANNZQFIW-UHFFFAOYSA-N.
| Molecular formula | C13H2Cl10S2 |
|---|---|
| Molecular weight | 576.8 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethylsulfanyl]benzene |
| InChIKey | BUNBGJANNZQFIW-UHFFFAOYSA-N |
| SMILES | C(SC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)SC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)