CAS 96481-90-2 is the registry number for Hydroxyacetone-2,4-DNPH. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol (CAS 96481-90-2) is a chemical compound with the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. IUPAC name: (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol. InChIKey: OKMYRYWRPTZQRR-UXBLZVDNSA-N.
| Molecular formula | C9H10N4O5 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propan-1-ol |
| InChIKey | OKMYRYWRPTZQRR-UXBLZVDNSA-N |
| SMILES | C/C(=N\NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])/CO |
Computed by PubChem (NCBI)