CAS 96514-08-8 is the registry number for Sodium Dideuterium Phosphate, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g.
Sodium dideuterio phosphate (CAS 96514-08-8) is a chemical compound with the molecular formula H2NaO4P and a molecular weight of 121.989 g/mol. IUPAC name: sodium dideuterio phosphate. InChIKey: AJPJDKMHJJGVTQ-ZSJDYOACSA-M.
| Molecular formula | H2NaO4P |
|---|---|
| Molecular weight | 121.989 g/mol |
| IUPAC name | sodium dideuterio phosphate |
| InChIKey | AJPJDKMHJJGVTQ-ZSJDYOACSA-M |
| SMILES | [2H]OP(=O)([O-])O[2H].[Na+] |
Computed by PubChem (NCBI)