Products 96551-81-4
CAS 96551-81-4 is the registry number for Arphamenine A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoic acid (CAS 96551-81-4) is a chemical compound with the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. IUPAC name: (2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoic acid. InChIKey: FQRLGZIGRMSTAX-OLZOCXBDSA-N.
| Molecular formula | C16H24N4O3 |
|---|---|
| Molecular weight | 320.39 g/mol |
| IUPAC name | (2R,5S)-5-amino-2-benzyl-8-(diaminomethylideneamino)-4-oxooctanoic acid |
| InChIKey | FQRLGZIGRMSTAX-OLZOCXBDSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CC(=O)[C@H](CCCN=C(N)N)N)C(=O)O |
Computed by PubChem (NCBI)