CAS 96680-90-9 is the registry number for 2-(4-Bromophenyl)-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 96680-90-9) is a chemical compound with the molecular formula C15H12BrNOS and a molecular weight of 334.2 g/mol. IUPAC name: 2-(4-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: HFZBGKJRIMUKTP-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNOS |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | HFZBGKJRIMUKTP-UHFFFAOYSA-N |
| SMILES | C1C(SC2=CC=CC=C2NC1=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)