CAS 967-95-3 is the registry number for Bis(2,3,5,6-tetrafluorophenyl)sulfide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)sulfanylbenzene (CAS 967-95-3) is a chemical compound with the molecular formula C12H2F8S and a molecular weight of 330.20 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)sulfanylbenzene. InChIKey: GTUBTAOGKIAJHC-UHFFFAOYSA-N.
| Molecular formula | C12H2F8S |
|---|---|
| Molecular weight | 330.20 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)sulfanylbenzene |
| InChIKey | GTUBTAOGKIAJHC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)SC2=C(C(=CC(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)