CAS 96740-32-8 appears in our catalog under these names: Parathion Methyl-d6, Parathion-methyl-d6, >95% (HPLC), Methyl Parathion-d6 (dimethyl-d6), 99 atom % D, min 95% Chemical Purity, Parathion-methyl D6 (dimethyl D6), Methyl Parathion–d6. Offered by: Chemat Brand, TRC, CDN, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 10mg, 5mg.
(4-nitrophenoxy)-sulfanylidene-bis(trideuteriomethoxy)-lambda5-phosphane (CAS 96740-32-8) is a chemical compound with the molecular formula C8H10NO5PS and a molecular weight of 269.25 g/mol. IUPAC name: (4-nitrophenoxy)-sulfanylidene-bis(trideuteriomethoxy)-lambda5-phosphane. InChIKey: RLBIQVVOMOPOHC-WFGJKAKNSA-N.
| Molecular formula | C8H10NO5PS |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (4-nitrophenoxy)-sulfanylidene-bis(trideuteriomethoxy)-lambda5-phosphane |
| InChIKey | RLBIQVVOMOPOHC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OP(=S)(OC1=CC=C(C=C1)[N+](=O)[O-])OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)