CAS 96762-04-8 is the registry number for 5-(4-Chlorophenyl)-3-((4-chlorophenyl)imino)-3,5-dihydro-2-phenazinamine. Offered by: TRC. Available pack sizes: 100mg.
5-(4-chlorophenyl)-3-(4-chlorophenyl)iminophenazin-2-amine (CAS 96762-04-8) is a chemical compound with the molecular formula C24H16Cl2N4 and a molecular weight of 431.3 g/mol. IUPAC name: 5-(4-chlorophenyl)-3-(4-chlorophenyl)iminophenazin-2-amine. InChIKey: YLXFVNMGWMBEKP-UHFFFAOYSA-N.
| Molecular formula | C24H16Cl2N4 |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3-(4-chlorophenyl)iminophenazin-2-amine |
| InChIKey | YLXFVNMGWMBEKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=C(C(=NC4=CC=C(C=C4)Cl)C=C3N2C5=CC=C(C=C5)Cl)N |
Computed by PubChem (NCBI)