CAS 96865-92-8 appears in our catalog under these names: Xanthine Impurity 1, Xanthine Amine Congener, Xanthine amine congener/ 99.7% (existing batch purity), XAC. Offered by: Hubei YoungXin, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, Get quote.
N-(2-aminoethyl)-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide (CAS 96865-92-8) is a chemical compound with the molecular formula C21H28N6O4 and a molecular weight of 428.5 g/mol. IUPAC name: N-(2-aminoethyl)-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide. InChIKey: FIQGIOAELHTLHM-UHFFFAOYSA-N.
| Molecular formula | C21H28N6O4 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide |
| InChIKey | FIQGIOAELHTLHM-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3=CC=C(C=C3)OCC(=O)NCCN |
Computed by PubChem (NCBI)