CAS 96881-90-2 appears in our catalog under these names: 2-Methoxy-4,6-dimethylbenzoic acid, 95%, 2-Methoxy-4,6-dimethylbenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-methoxy-4,6-dimethylbenzoic acid (CAS 96881-90-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methoxy-4,6-dimethylbenzoic acid. InChIKey: PAPFFSFFZKEPTP-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-methoxy-4,6-dimethylbenzoic acid |
| InChIKey | PAPFFSFFZKEPTP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C(=O)O)C |
Computed by PubChem (NCBI)