CAS 97057-70-0 is the registry number for 3–T–BUTYLDIMETHYLSILOXYPROPYLLITHIUM. Offered by: GLPBio. Available pack sizes: 10g.
Lithium tert-butyl-dimethyl-propoxysilane (CAS 97057-70-0) is a chemical compound with the molecular formula C9H21LiOSi and a molecular weight of 180.3 g/mol. IUPAC name: lithium tert-butyl-dimethyl-propoxysilane. InChIKey: JUSBBHFTGLNOEU-UHFFFAOYSA-N.
| Molecular formula | C9H21LiOSi |
|---|---|
| Molecular weight | 180.3 g/mol |
| IUPAC name | lithium tert-butyl-dimethyl-propoxysilane |
| InChIKey | JUSBBHFTGLNOEU-UHFFFAOYSA-N |
| SMILES | [Li+].CC(C)(C)[Si](C)(C)OCC[CH2-] |
Computed by PubChem (NCBI)