Products 97110-59-3
CAS 97110-59-3 is the registry number for Trazium esilate. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-chlorophenyl)-4H-[1,2,4]triazino[6,1-a]isoquinolin-5-ium-1-ol;ethanesulfonate (CAS 97110-59-3) is a chemical compound with the molecular formula C19H18ClN3O4S and a molecular weight of 419.9 g/mol. IUPAC name: 1-(4-chlorophenyl)-4H-[1,2,4]triazino[6,1-a]isoquinolin-5-ium-1-ol;ethanesulfonate. InChIKey: SHXJBCWOVPAZQL-UHFFFAOYSA-M.
| Molecular formula | C19H18ClN3O4S |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4H-[1,2,4]triazino[6,1-a]isoquinolin-5-ium-1-ol;ethanesulfonate |
| InChIKey | SHXJBCWOVPAZQL-UHFFFAOYSA-M |
| SMILES | CCS(=O)(=O)[O-].C1=CC=C2C(=C1)C=C[N+]3=C2C(N=CN3)(C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)