Products 97126-57-3
CAS 97126-57-3 appears in our catalog under these names: 6–Geranylnaringenin, Bonannione A, Bonannione A, 98%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 20mg, 1 mg.
(2S)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (CAS 97126-57-3) is a chemical compound with the molecular formula C25H28O5 and a molecular weight of 408.5 g/mol. IUPAC name: (2S)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: XYIQIBWIEGCVQY-RWHUQTJRSA-N.
| Molecular formula | C25H28O5 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (2S)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | XYIQIBWIEGCVQY-RWHUQTJRSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C2=C(C=C1O)O[C@@H](CC2=O)C3=CC=C(C=C3)O)O)/C)C |
Computed by PubChem (NCBI)