Products 97135-07-4
CAS 97135-07-4 appears in our catalog under these names: 2,5-Hexanedione-d10, 2,5-Hexanedione-d10, 98 atom % D, min 98% Chemical Purity, D10-2,5-Hexanedione. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 250mg, 500mg, 0,25g, 0,1g, 100 mg, 25 mg, 50 mg.
1,1,1,3,3,4,4,6,6,6-decadeuteriohexane-2,5-dione (CAS 97135-07-4) is a chemical compound with the molecular formula C6H10O2 and a molecular weight of 124.20 g/mol. IUPAC name: 1,1,1,3,3,4,4,6,6,6-decadeuteriohexane-2,5-dione. InChIKey: OJVAMHKKJGICOG-MWUKXHIBSA-N.
| Molecular formula | C6H10O2 |
|---|---|
| Molecular weight | 124.20 g/mol |
| IUPAC name | 1,1,1,3,3,4,4,6,6,6-decadeuteriohexane-2,5-dione |
| InChIKey | OJVAMHKKJGICOG-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)