Products 97180-66-0

CAS 97180-66-0 is the registry number for Ethyl 6-oxo-octahydro-1H-indene-3a-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate (CAS 97180-66-0) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: ethyl 6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate. InChIKey: WUEVMRBXTWODMK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O3
Molecular weight210.27 g/mol
IUPAC nameethyl 6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate
InChIKeyWUEVMRBXTWODMK-UHFFFAOYSA-N
SMILESCCOC(=O)C12CCCC1CC(=O)CC2

Computed by PubChem (NCBI)