CAS 97240-80-7 appears in our catalog under these names: Topiramate n-methyl impurity, 95%, Topiramate N-Methyl Impurity, N-Methyl Topiramate, N-Methyltopiramate, N-Methyl-Topiramate. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 100mg, 250mg, on request, 25mg, 50mg.
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-methylsulfamate (CAS 97240-80-7) is a chemical compound with the molecular formula C13H23NO8S and a molecular weight of 353.39 g/mol. IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-methylsulfamate. InChIKey: LDHJVCCWWXVXBN-DNJQJEMRSA-N.
| Molecular formula | C13H23NO8S |
|---|---|
| Molecular weight | 353.39 g/mol |
| IUPAC name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl N-methylsulfamate |
| InChIKey | LDHJVCCWWXVXBN-DNJQJEMRSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)COS(=O)(=O)NC)C |
Computed by PubChem (NCBI)