CAS 97247-12-6 appears in our catalog under these names: Acetylcysteine Impurity 28 (N,N'-Diacetyl-D-cystine), Acetylcysteine Impurity 29, (2S,2'S)-3,3'-Disulfanediylbis(2-acetamidopropanoic acid), 95%, N,N'-Diacetyl-D-cystine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(2S)-2-acetamido-3-[[(2S)-2-acetamido-2-carboxyethyl]disulfanyl]propanoic acid (CAS 97247-12-6) is a chemical compound with the molecular formula C10H16N2O6S2 and a molecular weight of 324.4 g/mol. IUPAC name: (2S)-2-acetamido-3-[[(2S)-2-acetamido-2-carboxyethyl]disulfanyl]propanoic acid. InChIKey: YTPQSLLEROSACP-HTQZYQBOSA-N.
| Molecular formula | C10H16N2O6S2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (2S)-2-acetamido-3-[[(2S)-2-acetamido-2-carboxyethyl]disulfanyl]propanoic acid |
| InChIKey | YTPQSLLEROSACP-HTQZYQBOSA-N |
| SMILES | CC(=O)N[C@H](CSSC[C@H](C(=O)O)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)