CAS 97278-42-7 appears in our catalog under these names: (1S,5R)-3,9-Diazabicyclo(3.3.2)decan-10-one, 98%, 3,9-Diazabicyclo(3.3.2)decan-10-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
(1S,5R)-3,9-diazabicyclo[3.3.2]decan-10-one (CAS 97278-42-7) is a chemical compound with the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. IUPAC name: (1S,5R)-3,9-diazabicyclo[3.3.2]decan-10-one. InChIKey: BWZHYLDHEREEEC-RQJHMYQMSA-N.
| Molecular formula | C8H14N2O |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (1S,5R)-3,9-diazabicyclo[3.3.2]decan-10-one |
| InChIKey | BWZHYLDHEREEEC-RQJHMYQMSA-N |
| SMILES | C1C[C@@H]2CNC[C@H](C1)NC2=O |
Computed by PubChem (NCBI)