Products 97338-86-8
CAS 97338-86-8 is the registry number for 2,3-Bis(acetyloxy)-3-(1,3-benzothiazol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoic acid (CAS 97338-86-8) is a chemical compound with the molecular formula C14H13NO6S and a molecular weight of 323.32 g/mol. IUPAC name: 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoic acid. InChIKey: SDFBJNWQKYDBAL-UHFFFAOYSA-N.
| Molecular formula | C14H13NO6S |
|---|---|
| Molecular weight | 323.32 g/mol |
| IUPAC name | 2,3-diacetyloxy-3-(1,3-benzothiazol-2-yl)propanoic acid |
| InChIKey | SDFBJNWQKYDBAL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=NC2=CC=CC=C2S1)C(C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)