CAS 97347-40-5 is the registry number for tert-Butyl (S)-2,6-bis((tert-butoxycarbonyl)amino)-6-oxohexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate (CAS 97347-40-5) is a chemical compound with the molecular formula C20H36N2O7 and a molecular weight of 416.5 g/mol. IUPAC name: tert-butyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate. InChIKey: KOLDSECLRRRIFP-ZDUSSCGKSA-N.
| Molecular formula | C20H36N2O7 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | tert-butyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
| InChIKey | KOLDSECLRRRIFP-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCC(=O)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)