CAS 97419-13-1 is the registry number for Triethyl Orthoacetate-d3. Offered by: TRC. Available pack sizes: 250mg.
1,1,1-trideuterio-2,2,2-triethoxyethane (CAS 97419-13-1) is a chemical compound with the molecular formula C8H18O3 and a molecular weight of 165.24 g/mol. IUPAC name: 1,1,1-trideuterio-2,2,2-triethoxyethane. InChIKey: NDQXKKFRNOPRDW-GKOSEXJESA-N.
| Molecular formula | C8H18O3 |
|---|---|
| Molecular weight | 165.24 g/mol |
| IUPAC name | 1,1,1-trideuterio-2,2,2-triethoxyethane |
| InChIKey | NDQXKKFRNOPRDW-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])C(OCC)(OCC)OCC |
Computed by PubChem (NCBI)