CAS 97524-40-8 is the registry number for 3-(4-Hydroxy-3-methyl-1H-pyrazolo[3,4-b]quinolin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)-3-methyl-9H-pyrazolo[5,4-b]quinolin-4-one (CAS 97524-40-8) is a chemical compound with the molecular formula C15H15N3O3S and a molecular weight of 317.4 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-3-methyl-9H-pyrazolo[5,4-b]quinolin-4-one. InChIKey: VSSLBMFNVAXCCP-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O3S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-3-methyl-9H-pyrazolo[5,4-b]quinolin-4-one |
| InChIKey | VSSLBMFNVAXCCP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=O)C3=CC=CC=C3N2)C4CCS(=O)(=O)C4 |
Computed by PubChem (NCBI)