CAS 1166386-02-2 appears in our catalog under these names: 2-(((3,4-Dimethoxypyridin-2-yl)methyl)thio)-1H-benzo[d]imidazol-6-ol, 95%, Pantoprazole Impurity 27, Pantoprazole Impurity 59. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol (CAS 1166386-02-2) is a chemical compound with the molecular formula C15H15N3O3S and a molecular weight of 317.4 g/mol. IUPAC name: 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol. InChIKey: GKSNBOSNBGPPIG-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O3S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol |
| InChIKey | GKSNBOSNBGPPIG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)CSC2=NC3=C(N2)C=C(C=C3)O)OC |
Computed by PubChem (NCBI)